Просмотр кода страницы Английская Википедия:2,4,6-Tri-tert-butylpyrimidine

{{Английская Википедия/Панель перехода}}
{{DISPLAYTITLE:2,4,6-Tri-''tert''-butylpyrimidine}}
{{Chembox
| Name = 2,4,6-Tri-''tert''-butylpyrimidine
| ImageFile = Chemical structure of TTBP.svg
| ImageSize = 
| ImageAlt = 
| PIN = 2,4,6-Tri-''tert''-butylpyrimidine
| OtherNames = 
|Section1={{Chembox Identifiers
| CASNo = 67490-21-5
| CASNo_Ref = {{Cascite|correct|CAS}}
| ChemSpiderID = 2682941
| EC_number = 628-674-7
| PubChem = 3440137
| StdInChI=1S/C16H28N2/c1-14(2,3)11-10-12(15(4,5)6)18-13(17-11)16(7,8)9/h10H,1-9H3
| StdInChIKey = VYWSYEDVFVGRGG-UHFFFAOYSA-N
| SMILES = CC(C)(C)C1=CC(=NC(=N1)C(C)(C)C)C(C)(C)C
 }}
|Section2={{Chembox Properties
| C=16|H=28|N=2
| MolarMass =
| Appearance = White or colorless solid
| Density = 
| MeltingPtC = 77-78
| BoilingPt = 
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt = }}
}}

'''2,4,6-Tri-''tert''-butylpyrimidine''' is the [[organic compound]] with the formula HC(Bu<sup>t</sup>C)<sub>2</sub>N<sub>2</sub>C<sup>t</sup>Bu where <sup>t</sup>Bu = (CH<sub>3</sub>)<sub>3</sub>C.  It is a substituted derivative of the heterocycle [[pyrimidine]].  Known also as TTBP, this compound is of interest as a base that is sufficiently bulky to not bind [[boron trifluoride]] but still able to bind protons.  It is less expensive that the related bulky derivatives of pyridine such as [[2,6-Di-tert-butylpyridine|2,6-di-''tert''-butylpyridine]],  2,4,6-tri-''tert''-butylpyridine, and 2,6-di-''tert''-butyl-4-methylpyridine.<ref>{{cite journal |doi=10.1055/s-2001-10798|title=2,4,6-Tri-''tert''-butylpyrimidine (TTBP): A Cost Effective, Readily Available Alternative to the Hindered Base 2,6-Di-tert-butylpyridine and its 4-Substituted Derivatives in Glycosylation and Other Reactions|year=2001|last1=Crich|first1=David|last2=Smith|first2=Mark|last3=Yao|first3=Qingjia|last4=Picione|first4=John|journal=Synthesis|volume=2001|issue=2|pages=0323–0326}}</ref>

==References==
<references />

{{DEFAULTSORT:Tri-tert-butylpyrimidine, 2,4,6-}}
[[Category:Pyrimidines]]
[[Category:Reagents for organic chemistry]]
[[Category:Non-nucleophilic bases]]
[[Category:Tert-butyl compounds]]
{{Навигационная таблица/Портал/Английская Википедия}}
[[Категория:Английская Википедия]]
[[Категория:Википедия]]
[[Категория:Статья из Википедии]]
[[Категория:Статья из Английской Википедии]]