Просмотр кода страницы Английская Википедия:5-Fluoro-5-deoxy-D-ribose 1-phosphate

{{Английская Википедия/Панель перехода}}
{{DISPLAYTITLE:5-Fluoro-5-deoxy-<small>D</small>-ribose 1-phosphate}}
{{Chembox
| Name=5-Fluoro-5-deoxy-{{small|D}}-ribose 1-phosphate
| ImageFile = 5-Fluoro-5-deoxy-D-ribose-1-phosphate.svg
| ImageSize = 200px
| IUPACName = 5-Deoxy-5-fluoro-{{small|D}}-ribofuranosyl dihydrogen phosphate
| PIN = (2''Ξ'',3''R'',4''S'',5''S'')-5-(Fluoromethyl)-3,4-dihydroxyoxolan-2-yl dihydrogen phosphate
| OtherNames = 
|Section1={{Chembox Identifiers
| index1_label = dianion
| CASNo = 721928-91-2
| CASNo_Ref = {{Cascite|changed|PubChem}}
| PubChem = 16757556
| PubChem1 = 49859615
| ChemSpiderID = 59700788
| ChemSpiderID1 = 21169315
| SMILES = O[C@@H]1[C@H](O)[C@@H](CF)OC1OP(=O)(O)O
| StdInChI=1S/C5H10FO7P/c6-1-2-3(7)4(8)5(12-2)13-14(9,10)11/h2-5,7-8H,1H2,(H2,9,10,11)/t2-,3-,4-,5?/m1/s1
| StdInChIKey=LUQFMENCTWEBSQ-SOOFDHNKSA-N
  }}
|Section2={{Chembox Properties
| C=5 | H=10 | F=1 | O=7 | P=1
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility =
  }}
|Section3={{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt =
  }}
}}

'''5-Fluoro-5-deoxy-{{small|D}}-ribose 1-phosphate''' is metabolite formed during the biosynthesis of organofluorides. It is formed by the [[purine nucleoside phosphorylase]] mediated phosphorolytic cleavage of [[5'-deoxy-5'-fluoroadenosine]].<ref>{{cite journal | author = O'Hagan D | author2 = Schaffrath C | author3 = Cobb SL | author4 = Hamilton JT | author5 = Murphy CD | date = 2002 | title = Biochemistry: biosynthesis of an organofluorine molecule | journal = Nature  | volume = 416 | pages = 279  | pmid = 11907567 | doi = 10.1038/416279a | issue = 6878| bibcode = 2002Natur.416..279O | s2cid = 4415511 | doi-access = free }}</ref> It is isomerized to 5-fluoro-5-deoxy-ribulose-1-phosphate which is then cleaved by an aldolase to release [[fluoroacetaldehyde]].<ref>{{cite journal | author = Hai Deng | author2 = Stuart M. Cross | author3 = Ryan P. McGlinchey| author4 = John T.G. Hamilton | author5 = David O'Hagan | date = 2008 | title = In Vitro Reconstituted Biotransformation of 4-Fluorothreonine from Fluoride Ion: Application of the Fluorinase | journal = Chemistry and Biology  | volume = 15 | pages = 1268–1276  | doi = 10.1016/j.chembiol.2008.10.012| pmid = 19101471 | issue = 12| doi-access =  }}</ref>

==References==
{{reflist}}

{{DEFAULTSORT:Fluoro-5-deoxy-D-ribose 1-phosphate, 5-}}
[[Category:Organofluorides]]
[[Category:Organophosphates]]
[[Category:Halogen-containing natural products]]
[[Category:Fluorine-containing natural products]]
{{Навигационная таблица/Портал/Английская Википедия}}
[[Категория:Английская Википедия]]
[[Категория:Википедия]]
[[Категория:Статья из Википедии]]
[[Категория:Статья из Английской Википедии]]