Просмотр кода страницы Английская Википедия:6-Chloro-5-ethoxy-N-(pyridin-2-yl)indoline-1-carboxamide

{{Английская Википедия/Панель перехода}}
{{Short description|Chemical compound}}
{{DISPLAYTITLE:6-Chloro-5-ethoxy-''N''-(pyridin-2-yl)indoline-1-carboxamide}}
{{Drugbox
| IUPAC_name = 6-Chloro-5-ethoxy-''N''-(pyridin-2-yl)indoline-1-carboxamide
| drug_name = 6-Chloro-5-ethoxy-''N''-(pyridin-2-yl)indoline-1-carboxamide
| image = CEPC_structure.png
| width = 220

<!--Clinical data-->
| tradename =  
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA =  
| legal_UK =  
| legal_US =  
| legal_status =  
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 1384929-25-2
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2BY259EY9C
| ATC_prefix =  
| ATC_suffix =  
| PubChem = 57515146

<!--Chemical data-->
| C=16 | H=16 | Cl=1 | N=3 | O=2 
| smiles = c3cccnc3NC(=O)N(c1cc2Cl)CCc1cc2OCC
}}

'''6-Chloro-5-ethoxy-''N''-(pyridin-2-yl)indoline-1-carboxamide''' ('''CEPC''') is a drug which acts as a potent and selective [[Antagonist (pharmacology)|antagonist]] for the [[serotonin]] [[5-HT2C receptor|5-HT<sub>2C</sub>]] [[Receptor (biochemistry)|receptor]]. In animal studies it was found to potentiate the [[conditioned place preference]] induced by low-dose [[amphetamine]], demonstrating that 5-HT<sub>2C</sub>-mediated disinhibition of dopamine release can cause interactions with dopaminergic drugs.<ref>{{cite journal | vauthors = McCorvy JD, Harland AA, Maglathlin R, Nichols DE | title = A 5-HT(2C) receptor antagonist potentiates a low dose amphetamine-induced conditioned place preference | journal = Neuroscience Letters | volume = 505 | issue = 1 | pages = 10–3 | date = November 2011 | pmid = 21827831 | pmc = 3213641 | doi = 10.1016/j.neulet.2011.07.036 }}</ref>

== See also ==
* [[RS-102,221]]
* [[SB-242,084]]
* [[SCQ1]]

== References ==
{{reflist}}

{{Serotonergics}}

{{DEFAULTSORT:Chloro-5-ethoxy-''N''-(pyridin-2-yl)indoline-1-carboxamide, 6-}}
[[Category:5-HT2C antagonists]]
[[Category:Pyridines]]
[[Category:Chloroarenes]]
[[Category:Ureas]]
[[Category:Ethoxy compounds]]
[[Category:Indolines]]
{{Навигационная таблица/Портал/Английская Википедия}}
[[Категория:Английская Википедия]]
[[Категория:Википедия]]
[[Категория:Статья из Википедии]]
[[Категория:Статья из Английской Википедии]]