Просмотр кода страницы Английская Википедия:Isopromethazine

{{Английская Википедия/Панель перехода}}
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 443887428
| IUPAC_name = ''N'',''N''-Dimethyl-2-(10''H''-phenothiazin-10-yl)propan-1-amine
| image = Isopromethazine.png

<!--Clinical data-->
| tradename =  
| MedlinePlus = a682284
| pregnancy_category =  
| legal_status =  
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 303-14-0
| ATC_prefix = none
| ATC_suffix =  
| PubChem = 110669
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 044033O3TY
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID      = 99332

<!--Chemical data-->
| C=17 | H=20 | N=2 | S=1 
| smiles = CC(CN(C)C)N1C2=CC=CC=C2SC3=CC=CC=C31
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI          = 1S/C17H20N2S/c1-13(12-18(2)3)19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey       = CGNHCKZJGQDWBG-UHFFFAOYSA-N
}}

'''Isopromethazine''' is an [[antihistamine]] and [[anticholinergic]] of the [[phenothiazine]] [[chemical class]]. It is [[chemical structure|structurally]] [[analogous]] to [[promethazine]].<ref name="pmid13125690">{{cite journal | vauthors = Edge ND | title = The pharmacological differentiation of promethazine hydrochloride (phenergan) from iso-promethazine hydrochloride | journal = Archives Internationales de Pharmacodynamie et de Therapie | volume = 95 | issue = 3–4 | pages = 428–36 | date = September 1953 | pmid = 13125690 | doi = | url = }}</ref>

== See also ==
* [[Promethazine]]

== References ==
{{Reflist|2}}

{{Cholinergics}}
{{Histaminergics}}
{{Tricyclics}}

[[Category:Phenothiazines]]
[[Category:H1 receptor antagonists]]


{{pharmacology-stub}}
{{Навигационная таблица/Портал/Английская Википедия}}
[[Категория:Английская Википедия]]
[[Категория:Википедия]]
[[Категория:Статья из Википедии]]
[[Категория:Статья из Английской Википедии]]