Английская Википедия:(Norbornadiene)molybdenum tetracarbonyl

Материал из Онлайн справочника
Версия от 00:31, 18 декабря 2023; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | ImageFile1 = Mo(nbd)(CO)4.png | ImageSize1 = | ImageFile2 = Mo(nbd)(CO)4 sample (with spatula).jpg | ImageSize2 = | ImageAlt = | IUPACName = | OtherNames = |Section1={{Chembox Identifiers | CASNo = 12146-37-1 | ChemSpiderID = 452413 | PubChem = 11370028 | DTXSID = DTXSID90153276 | StdInChI=1S/C7H8.4CO.Mo/c1-2-7-4-3-6(1)5-7;4*1-2;/h1-4,6-7H,5H2;;;;; | StdInChIKey = UZHY...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox


(Norbornadiene)molybdenum tetracarbonyl is the organomolybdenum compound with the formula (C7H9)Mo(CO)4. Structurally, the compound consists of the norbornadiene bonded to a Mo(CO)4 fragment. The compound is a yellow, volatile solid. It is prepared by thermal or photochemical substitution of molybdenum hexacarbonyl.[1] The compound was originally examined as a potential antiknock agent.[2]

(Norbornadiene)molybdenum tetracarbonyl is a precursor to other derivatives of the type L2Mo(CO)4. This conversion exploits the lability of the diene ligand:[3]

(C7H9)Mo(CO)4 + 2 L → C7H9 + L2Mo(CO)4

References

Шаблон:Reflist

External links