Английская Википедия:(R)-69

Материал из Онлайн справочника
Версия от 00:33, 18 декабря 2023; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Short description|Chemical compound}} {{drugbox | IUPAC_name = 3-[(5R)-5-methyl-1,2,5,6-tetrahydropyridin-3-yl]-1H-pyrrolo[2,3-b]pyridine | image = R69_structure.png | legal_UK = | legal_DE = | C = 13 | H = 15 | N = 3 | CAS_number = | ChemSpiderID = | PubChem = 164513426 | smiles = C[C@@H]1C=C(CNC1)c1c[NH]c2ncccc12 | StdInChI = 1S/C13H15N3/c1-9-5-10(7-14-...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Short description Шаблон:Drugbox

(R)-69 (3IQ) is a tetrahydropyridine derivative which acts as a 5-HT2A receptor agonist, with 4.6x selectivity over 5-HT2B and 49x selectivity over 5-HT2C. It has a 5-HT2A Ki of 680nM and an EC50 of 41nM. (R)-69 is a biased agonist selective for activation of the Gq coupled signalling pathway, with much weaker activation of the β-arrestin 2 coupled pathway. In animal studies it produces antidepressant-like activity but without producing the head-twitch response associated with psychedelic effects.[1]

See also

References

Шаблон:Reflist


Шаблон:Nervous-system-drug-stub

Партнерские ресурсы
Криптовалюты
Магазины
Хостинг
Разное

  1. ↑ Шаблон:Cite journal
Источник — http://wikihandbk.com/ruwiki/index.php?title=Английская_Википедия:(R)-69&oldid=12480812