Английская Википедия:(Triphenylphosphine)iron tetracarbonyl

Материал из Онлайн справочника
Версия от 00:38, 18 декабря 2023; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | ImageFile = FeP(CO)4.svg | ImageSize = 120 | ImageAlt = | IUPACName = | OtherNames = |Section1={{Chembox Identifiers | CASNo = 35679-07-3 | PubChem = 518983 | ChemSpiderID = 4807513 | StdInChI=1S/C18H15P.4CO.Fe/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4*1-2;/h1-15H;;;;; | StdInChIKey = GHXDZMLBRWBQAM-UHFFFAOYSA-N | SMILES = [C-]#[O+].[C-]#[O+].[C-]#[O+]...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox

(Triphenylphosphine)iron tetracarbonyl is a coordination complex with the formula Fe(CO)4(PPh3) (Ph = C6H5). An off-white solid, this complex is derived from iron pentacarbonyl by replacement of one carbonyl ligand by triphenylphosphine (PPh3).

Synthesis and use

The title complex can be prepared by reaction of iron pentacarbonyl or triiron dodecacarbonyl with triphenylphosphine:[1]

Шаблон:Chem2

The substitution is catalyzed by cobalt chloride.[2]

(Triphenylphosphine)iron tetracarbonyl is an intermediate in the synthesis of bis(triphenylphosphine)iron tricarbonyl. Both the mono- and bis(triphenylphosphine) complexes were originally employed in pioneering research on homogeneous catalysis by Walter Reppe.[3]

References