Английская Википедия:1,1'-Binaphthyl

Материал из Онлайн справочника
Версия от 02:29, 18 декабря 2023; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | ImageFile = Binaphthyl.svg | ImageSize = 160 px | ImageAlt = | PIN = 1,1{{prime}}-Binaphthalene | OtherNames = 1-Naphthalen-1-ylnaphthalene |Section1={{Chembox Identifiers | CASNo = 604-53-5 | PubChem = 11789 | UNII = T87T28S609 | SMILES = C1=CC=C2C(=C1)C=CC=C2C3=CC=CC4=CC=CC=C43}} |Section2={{Chembox Properties | C=20|H=14 | MolarMass = | Appearance = Colorless solid | D...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox

1,1'-Binaphthyl is an organic compound with the formula (CШаблон:SubHШаблон:Sub)Шаблон:Sub. It is one of the dimers of naphthalene (or literally: dimers of naphthyl). A colorless solid, it has attracted some attention because the atropisomers can be isolated due to hindered rotation between the two naphthyl subunits. The halflife of the racemization is 14.5 min. at 50 °C. Substituted derivatives of this parent species, e.g. binaphthol, exhibit much higher barriers to racemization.[1]

References

Шаблон:Reflist