Английская Википедия:1,2-Cyclopentanedione

Материал из Онлайн справочника
Версия от 02:33, 18 декабря 2023; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | ImageFile = 1,2-Cyclopentanedione.png | ImageSize = | ImageAlt = | PIN = Cyclopentane-1,2-dione | OtherNames = |Section1={{Chembox Identifiers | CASNo = 3008-40-0 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = DQ8L4K1DLJ | PubChem = 566657 | ChemSpiderID = 492605 | StdInChI=1S/C5H6O2/c6-4-2-1-3-5(4)7/h1-3H2 | StdInChIKey = CIISBNCSMV...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox

1,2-Cyclopentanedione is the organic compound with the formula (CH2)3(CO)2. It is one of two isomeric cyclopentanediones, the other being 1,3-cyclopentanedione. It was first prepared by base-induced condensation of di ethylglutarate with diethyloxalate, followed by hydrolysis of the resulting diketodiester followed by decarboxylation.[1] The enol is predicted to be about 1-3 kcal/mol more stable than the diketo form.[2] The enol structure has been confirmed by X-ray crystallography.[3]

Structurally related to 1,2-cyclopentanedione is 2-hydroxy-3-methyl-2-cyclopenten-1-one is a flavor additive, also called cyclotene.

References

Шаблон:Reflist