Английская Википедия:2,4,5-Trihydroxyamphetamine

Материал из Онлайн справочника
Версия от 13:35, 21 декабря 2023; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | ImageFile = 2,4,5-trihydroxyamphetamine.svg | ImageSize = 200px | ImageAlt = | PIN = 5-(2-Aminopropyl)benzene-1,2,4-triol | OtherNames = | Section1 = {{Chembox Identifiers | CASNo = 136706-33-7 | ChEMBL = 28225 | PubChem = 126234 | ChemSpiderID = 112205 | UNII = C6JI2489W2 | SMILES = CC(N)CC1=C(O)C=C(O)C(O)=C1 | StdInChI=1S/C9H13NO3/c1-5(10)2-6-3-8(12)9(13)4-7(6)11/h3-5,1...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox 2,4,5-Trihydroxyamphetamine (THM) is a neurotoxin and a metabolite of MDMA. It comes from the ring-hydroxylation of 3,4-methylenedioxyamphetamine (MDA).

In one paper, it was shown to reduce hippocampal tryptophan hydroxylase activity by 54% after short-term treatment.[1] In another study, it was shown to significantly reduce striatal tyrosine hydroxylase activity.[2]

See also

References

Шаблон:Reflist

Шаблон:Neurotoxins


Шаблон:Neurotoxin-stub