Английская Википедия:AC-42

Материал из Онлайн справочника
Версия от 23:11, 26 декабря 2023; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | ImageFile = AC-42 Structure.svg | ImageSize = 200px | PIN = 4-n-butyl-1-(4-(2-methylphenyl)-4-oxo-1-butyl)-piperidine | OtherNames = | Section1 = {{Chembox Identifiers | CASNo = 244291-63-2 | CASNo_Ref = {{Cascite|correct|ChemSpider}} | ChEMBL = 1242950 | IUPHAR_ligand = 289 | PubChem = 9948320 | ChemSpiderID = 8123931 | SMILES = O=C(C=1C=CC=CC1C)CCCN2CCC(CC2)CCCC | StdI...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox

AC-42 is a selective, allosteric agonist of the M1 muscarinic acetylcholine receptor. AC-42 was the first selective M1 agonist to be discovered and its derivatives have been used to study the binding domain of the M1 receptor.[1][2][3]

References

Шаблон:Reflist

Шаблон:Muscarinic acetylcholine receptor modulators


Шаблон:Organic-compound-stub