Английская Википедия:Alrestatin

Материал из Онлайн справочника
Версия от 20:22, 29 января 2024; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | ImageFile = Alrestatin.svg | ImageSize = 160px | ImageAlt = | PIN = (1,3-Dioxo-1''H''-benzo[''de'']isoquinolin-2(3''H'')-yl)acetic acid | OtherNames = |Section1={{Chembox Identifiers | CASNo = 51411-04-2 | PubChem = 2120 | ChemSpiderID = 2036 | ChEMBL = 63055 | UNII = 515DHK15LG | KEGG = D02835 | SMILES = C1=CC2=C3C(=C1)C(=O)N(C(=O)C3=CC=C2)CC(=O)O | InChI = 1/C14H9NO4/c1...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox

Alrestatin is an inhibitor of aldose reductase, an enzyme involved in the pathogenesis of complications of diabetes mellitus, including diabetic neuropathy.[1][2]

Alrestat was first synthesized in 1969 and was the first aldose reductase inhibitor (ARI) with oral bioavailability to undergo clinical trials, in the late 1970s and early 1980s. Low-quality trials and a high incidence of adverse effects (particularly hepatotoxicity) led to termination of its development, and it was never in clinical use.[3][4] It is structurally related to tolrestat, another ARI that was briefly marketed before being withdrawn in 1997.

Synthesis

Alrestatin can be synthesized by the reaction of naphthalic anhydride with glycine.[5]

Файл:Alrestatin synthesis.png
Alrestatin synthesis

See also

References

Шаблон:Reflist