Английская Википедия:Aspidospermidine

Материал из Онлайн справочника
Версия от 12:44, 3 февраля 2024; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | ImageFile = Aspidospermidine.svg | ImageSize = 200px | IUPACName = (3a''R'',10b''R'')-3aβ-Ethyl-2,3,3a,4,5,5aα,6,11,12,13aβ-decahydro-1''H''-indolizino[8,1-''cd'']carbazole | OtherNames = | Section1 = {{Chembox Identifiers | CASNo = 2912-09-6 | PubChem = 6857472 | ChemSpiderID = 5256809 | ChEBI = 38486 | SMILES = CC[C@]12CCCN3[C@H]1[C@]4(CC3)c5ccccc5N[C@@H]4CC2 | I...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox

Aspidospermidine is an alkaloid isolated from plants in the genus Aspidosperma.[1] It has been a popular target for total synthesis,[2][3][4][5] due in part to the fact that it provides a good showcase for synthetic strategies but also because the structure is similar to many other important bioactive molecules.[6]

References

Шаблон:Reflist

Шаблон:Alkaloid-stub