Английская Википедия:Benzamidenafil

Материал из Онлайн справочника
Версия от 05:17, 8 февраля 2024; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | ImageFile = Benzamidenafil.svg | ImageSize = 200px | ImageAlt = | PIN = ''N''-[(3,4-Dimethoxyphenyl)methyl]-2-[(1-hydroxypropan-2-yl)amino]-5-nitrobenzamide | OtherNames = Xanthoanthrafil |Section1={{Chembox Identifiers | CASNo = 1020251-53-9 | SMILES = COC1=C(OC)C=C(CNC(=O)C2=CC(=CC=C2NC(C)CO)[N+]([O-])=O)C=C1 | PubChem = 10110873 | ChemSpiderID = 8286399 | UNII = B6ZMZ87...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox

Benzamidenafil or xanthoanthrafil is a synthetic drug that acts as a PDE5 inhibitor. It has the same mechanism of action as pharmaceutical drugs used to treat erectile dysfunction,[1] but it is not approved by any regulatory agency for such use. It has been found as an undeclared adulterant in supposedly "natural" health supplements.[1] In 2009, the supplement manufacturer Hi-Tech Pharmaceuticals recalled its product Stamina-Rx because it was adulterated with benzamidenafil.[2]

References

Шаблон:Reflist

Шаблон:Genito-urinary-drug-stub