Английская Википедия:Brevifolin

Материал из Онлайн справочника
Версия от 17:55, 11 февраля 2024; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | ImageFile = Brevifolin.svg | ImageSize = 200px | PIN = 1-(2-Hydroxy-4,6-dimethoxyphenyl)ethan-1-one | OtherNames = |Section1={{Chembox Identifiers | CASNo = 90-24-4 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = Z8RSY5TZPA | PubChem = 66654 | ChemSpiderID = 60021 | SMILES = CC(=O)C1=C(C=C(C=C1OC)OC)O | InChI = 1/C10H12O4/c1-6(11)10-8(12...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox Brevifolin is a bioactive compound found in pomegranate.[1] The pharmacological profile of brevifolin is reported similar to ellagic acid, particularly with regards to absorption, distribution, and elimination rates.[2]

References

Шаблон:Reflist

Шаблон:Aromatic-stub