Английская Википедия:Bromopentafluorobenzene

Материал из Онлайн справочника
Версия от 04:15, 12 февраля 2024; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | ImageFile = C6F5Br.png | ImageSize = 122 | ImageAlt = | PIN = Bromopenta(fluoro)benzene | OtherNames = Bromoperfluorobenzene |Section1={{Chembox Identifiers | CASNo = 344-04-7 | PubChem = 9578 | EC_number = 206-449-0 | UNII = S88219080S | ChemSpiderID = 21168727 | ChEMBL = 1231233 | StdInChI=1S/C6BrF5/c7-1-2(8)4(10)6(12)5(11)3(1)9 | StdInChIKey = XEKTVXADUPBFOA-UHFFFAOYSA-...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox Bromopentafluorobenzene is an organofluorine compound with the formula C6F5Br. It is a colorless liquid that is used to prepare pentafluophenyl compounds. These syntheses typically proceed via the intermediacy of C6F5Li or the Grignard reagent.[1] Illustrative is preparation of tris(pentafluorophenyl)borane:[2]

3 C6F5MgBr + BCl3 → (C6F5)3B + 3 MgBrCl

Other derivatives include LiB(C6F5)4,[3] [CuC6F5]4,[1] and Ni(C6F5)2(dioxane)2.[4]

References

Шаблон:Reflist

  1. 1,0 1,1 Шаблон:Cite journal
  2. Piers, W. E.; Chivers, T. “Pentafluorophenylboranes: from Obscurity to Applications”, Chemical Society Reviews, 1997, 26, 345-354. Шаблон:Doi
  3. Шаблон:Cite encyclopedia
  4. Шаблон:Cite journal