Английская Википедия:CIM-0216

Материал из Онлайн справочника
Версия от 12:12, 13 февраля 2024; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | ImageFile = CIM-0216_structure.png | ImageSize = 200px | ImageAlt = | PIN = 2-(3,4-Dihydroquinolin-1(2''H'')-yl)-''N''-(5-methyl-1,2-oxazol-3-yl)-2-phenylacetamide | OtherNames = |Section1={{Chembox Identifiers | CASNo = 1031496-06-6 | PubChem = 42887770 | SMILES = CC1=CC(=NO1)NC(=O)C(C2=CC=CC=C2)N3CCCC4=CC=CC=C43 | ChemSpiderID = 21960401 | ChEMBL = 4303225 | StdInChI = 1...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox

CIM-0216 is a chemical compound which acts as a potent and selective activator of the TRPM3 calcium channel. It produces nociception and inflammation and is used to study the function of the TRPM3 receptor in these processes.[1][2][3][4]

References

Шаблон:Reflist

Шаблон:Transient receptor potential channel modulators