Английская Википедия:Calcium tartrate

Материал из Онлайн справочника
Версия от 02:24, 14 февраля 2024; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{chembox | Watchedfields = changed | verifiedrevid = 399704354 | Name = Calcium tartrate | ImageFile = Calcium L-tartrate Structural Formula V1.svg | ImageSize = 200px | ImageName = | IUPACName = 2,3-Dihydroxybutanedioic acid calcium salt | Section1 = {{Chembox Identifiers | SMILES = [Ca+2].O=C([O-])C(O)C(O)C([O-])=O | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSp...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox

Calcium tartrate, exactly calcium L-tartrate, is a byproduct of the wine industry, prepared from wine fermentation dregs.[1][2][3] It is the calcium salt of L-tartaric acid, an acid most commonly found in grapes. Its solubility decreases with lower temperature, which results in the forming of whitish (in red wine often reddish) crystalline clusters as it precipitates. As E number E354, it finds use as a food preservative and acidity regulator. Like tartaric acid, calcium tartrate has two asymmetric carbons, hence it has two chiral isomers and a non-chiral isomer (meso-form). Most calcium tartrate of biological origin is the chiral levorotatory (–) isomer.

References


Шаблон:Organic-compound-stub