Английская Википедия:Diiron propanedithiolate hexacarbonyl

Материал из Онлайн справочника
Версия от 10:43, 27 февраля 2024; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | ImageFile = Fe2(pdt)(CO)6.png | ImageSize = | ImageAlt = | IUPACName = | OtherNames = |Section1={{Chembox Identifiers | CASNo = 70789-83-2 | PubChem = 139250566 | StdInChI=1S/C3H8S2.6CO.2Fe/c4-2-1-3-5;6*1-2;;/h4-5H,1-3H2;;;;;;;;/p-2 | StdInChIKey = ZHHRDZYBLRXFMT-UHFFFAOYSA-L | SMILES = O=[C][Fe]12([C]=O)([C]=O)[S]3CCC[S]1[Fe]23([C]=O)([C]=O)[C]=O }} |Section2={{Chembox...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox

Diiron propanedithiolate hexacarbonyl is the organoiron complex with the formula Fe2(S2C3H6)(CO)6. It is a red diamagnetic solid.[1] It adopts a symmetrical structure with six terminal CO ligands.[2] The complex is a precursor to hydrogenase mimics.

It is prepared by the reaction of 1,3-propanedithiol with triiron dodecarbonyl:

2 Fe3(CO)12 + 3 C3H6(SH)2 → 3 Fe2(S2C3H6)(CO)6 + 3 H2 + 6 CO

In general, the CO ligands can be substituted by cyanide, phosphines, isocyanides, N-heterocyclic carbenes, and other donor ligands. Monosubstitution can be achieved through an in situ generation of the acetonitrile complex.[3][4]

Upon irradiation of Fe2(S2C3H6)(CO)6 with ultraviolet (UV) light, CO-photolysis occurs with the transient formation of the unsaturated species followed by the formation of the solvent adduct.[5]

References

Шаблон:Reflist Шаблон:Iron compounds

  1. Winter, A., Zsolnai, L., Huttner, G., "Zweikernige und dreikernige Carbonyleisenkomplexe mit 1,2- und 1,3-Dithiolatobrückenliganden", Z. Naturforsch. 1982, 37b, 1430.
  2. Lyon, E. J., Georgakaki, I. P., Reibenspies, J. H., Darensbourg, M. Y., "Carbon Monoxide and Cyanide Ligands in a Classical Organometallic Complex Model for Fe-Only Hydrogenase", Angew. Chem. Int. Ed. 1999, 38, 3178.
  3. Mack, A.; Rauchfuss, T. B., "(1,3-Propanedithiolato)hexacarbonyl and Cyanide Derivatives", Inorganic Synthesis. 2010, volume 35, 143. Шаблон:Doi
  4. Works, C., "Laboratory Experiment or Mini-Project for Inorganic Chemistry or Integrated Laboratory", Journal of Chemical Education. 2007, 84, 836.
  5. Mack, A. R. Ridley, A. I. Stewart, K. Adamczyk, H. N. Ghosh, B. Kerkeni, Z. X. Guo, E. T. J. Nibbering, C. J. Pickett, N. T. Hunt "(1,3-Propanedithiolato)hexacarbonyl and Cyanide Derivatives", Inorg. Chem. 2008, 47, 7453-7455 Шаблон:Doi