Английская Википедия:Dimethylcarbamoyl fluoride

Материал из Онлайн справочника
Версия от 11:52, 27 февраля 2024; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | Name = Dimethylcarbamoyl fluoride | ImageFile = Dimethylcarbamoyl fluoride.svg | ImageSize = 120px | PIN = Dimethylcarbamoyl fluoride | Section1 = {{Chembox Identifiers | CASNo = 431-14-1 | ChemSpiderID = 9507 | PubChem = 9891 | SMILES = CN(C)C(=O)F | StdInChI=1S/C3H6FNO/c1-5(2)3(4)6/h1-2H3 | StdInChIKey = IRSDGYFTDVBVAK-UHFFFAOYSA-N }} | Section2 = {{Chembox Properties | C...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox

Dimethylcarbamoyl fluoride is a chemical compound that can be produced by fluorination of dimethylcarbamoyl chloride with potassium fluoride.[1] It's a colorless liquid that is soluble and stable in water.[2][3]

Dimethylcarbamoyl fluoride is highly toxic because it's a potent cholinesterase inhibitor and is lethal even at low doses.[2][3]

See also

References

Шаблон:Reflist

Шаблон:Acetylcholine metabolism and transport modulators

Шаблон:Organic-compound-stub