Английская Википедия:Fluoride phosphate

Содержание

Текст

Текст

Текст

Текст

Текст

Текст

Текст

Текст

Текст

The fluoride phosphates or phosphate fluorides are inorganic double salts that contain both fluoride and phosphate anions. In mineralogy, Hey's Chemical Index of Minerals groups these as 22.1. The Nickel-Strunz grouping is 8.BN.

Related mixed anion compounds are the chloride phosphates, the fluoride arsenates and fluoride vanadates.

They are distinct from the fluorophosphates: monofluorophosphate, difluorophosphate and hexafluorophosphate which have fluorine bonds to the phosphorus.

Minerals

name	formula	ratio PO4:F	formula weight	crystal system	space group	unit cell	volume	density	refractive index	comment	reference
Althausite	Mg4(PO4)2(OH,O)(F,☐)	2:~1		Orthorhombic	Pnma	a = 8.258 b = 6.054, c = 14.383	719.06	2.97	Biaxial (+) nα = 1.588 nβ = 1.592 nγ = 1.598 2V: measured: 70° , calculated: 80° Max birefringence: δ = 0.010
Amblygonite	LiAl(PO4)F	1:1		Triclinic	PШаблон:Overbar	a = 6.644 b = 7.744 c = 6.91 α = 90.35°, β = 117.33°, γ = 91.01° Z=4	315.75	3.04-3.11	Biaxial (-) nα = 1.577 - 1.591 nβ = 1.592 - 1.605 nγ = 1.596 - 1.613 2V: Measured: 107° to 129.5° Birefringence: 0.020
aravaite	Ba2Ca18(SiO4)6(PO4)3(CO3)F3O	3:3		trigonal	RШаблон:Overbarm	a = 7.1255, c = 66.290 Z=3	2914.8
Arctite	Na2Ca4(PO4)3F	3:1		Trigonal	RШаблон:Overbarm	a = 7.078 c = 41.203 Z=6	1,787.64	3.13	Uniaxial (-) nω = 1.578 nε = 1.577 Birefringence: 0.001
Ariegilatite	BaCa12(SiO4)4(PO4)2F2O			Trigonal	RШаблон:Overbarm	a = 7.1551 c = 41.303	1381.2		Uniaxial (-) nω = 1.650 nε = 1.647 Max Birefringence: δ = 0.003
Babefphite	BaBePO4(F,OH)	1:~1		Tetragonal					Uniaxial (+) nω = 1.629 nε = 1.632 Max birefringence: δ = 0.003
Belovite-(Ce)	NaCeSr3(PO4)3F	3:1		Trigonal	PШаблон:Overbar	a = 9.692 c = 7.201	585.80	4.19	Uniaxial (-) nω = 1.653 - 1.660 nε = 1.634 - 1.640 Birefringence: 0.015
Belovite-(La)	NaLaSr3(PO4)3F	3:1		Trigonal	PШаблон:Overbar	a = 9.647 c = 7.17	577.88	4.19	Uniaxial (-) nω = 1.653 nε = 1.635 - 1.636 Max birefringence: δ = 0.018
Bøggildite	Na2Sr2Al2PO4F9	1:9		Monoclinic					Biaxial (+) nα = 1.462 nβ = 1.466 nγ = 1.469 2V: 80° Max birefringence:δ = 0.007
Carlgieseckeite-(Nd)	NaNdCa3(PO4)3F			Trigonal	PШаблон:Overbar	a = 9.4553 c = 6.9825	540.62	3.91
Cloncurryite	Cu0.5(VO)0.5Al2(PO4)2F2 · 5H2O	2:2		Monoclinic	P21/b	a = 4.9573 b = 12.1824 c = 18.9749 β = 90.933° Z=4	1145.78	2.525	Biaxial (-) nα = 1.548(2) nγ = 1.550(2) 2V: calculated: 56° Max brefringence: δ = 0.002
Deloneite	(Na0.5REE0.25Ca0.25)(Ca0.75REE0.25)Sr1.5(CaNa0.25REE0.25)(PO4)3F0.5(OH)0.5			Trigonal	P3	a = 9.51 c = 7.01 Z=2	549.05	3.92	Uniaxial (-) nω = 1.682 nε = 1.660 Max birefringence: δ = 0.022
Fluellite	Al2(PO4)F2(OH) · 7H2O			Orthorhombic	Fddd	a = 11.22 b = 21.15 c = 8.54	2,027	2.139 - 2.17	Biaxial (+) nα = 1.473 - 1.490 nβ = 1.490 - 1.496 nγ = 1.506 - 1.511 Max birefringence: δ = 0.033
Fluorapatite	Ca5(PO4)3F	3:1		Hexagonal	P63/m	a = 9.3973 c = 6.8782	526.03	3.1-3.25	Uniaxial (-) nω = 1.631 - 1.650 nε = 1.627 - 1.646 Birefringence: 0.004
Fluorcaphite	SrCaCa3(PO4)3F	3:1		Hexagonal	P63/m	a = 9.485 c = 7.000 Z=2	545.39		Uniaxial (-) nω = 1.649 nε = 1.637 Max birefringence: δ = 0.012
Fluorphosphohedyphane	Ca2Pb3(PO4)3F	3:1		Hexagonal	P63/m	a = 9.640, c = 7.012 Z=2	564.4	5.445	Uniaxial (-) nω = 1.836 nε = 1.824 Max birefringence: δ = 0.012
Fluorstrophite	SrCaSr3(PO4)3F	3:1		Hexagonal	P63/m	a = 9.565 c = 7.115 Z=2	563.74		Uniaxial (-) nω = 1.651 nε = 1.637 Max birefringence: δ = 0.014
Francolite
Herderite	CaBe(PO4)F			Monoclinic		a = 4.81, b = 7.7 c = 9.82 β = 90.1°	363.7	3.02	Biaxial (-) nα = 1.556 - 1.592 nβ = 1.578 - 1.610 nγ = 1.589 - 1.620 2V: calculated: 70° Max birefringence: δ = 0.033
Iangreyite	Ca2Al7(PO4)2(PO3OH)2(OH,F)15 · 8H2O	4:~15		Trigonal	P3 2 1	a = 6.988 c = 16.707	706.5
Isokite	CaMg(PO4)F			Monoclinic	B2/b	a = 6.52 b = 8.75 c = 7.51 β = 121.47°	365.4	3.15-3.27	Biaxial (+) nα = 1.590 nβ = 1.595 nγ = 1.615 2V: ,easured: 51° Max birefringence: δ = 0.025
Kingite	Al3(PO4)2F2(OH) · 7H2O	2:2		Triclinic		a = 9.15 b = 10 c = 7.24 α = 98.6°, β = 93.6°, γ = 93.2°			Biaxial
Kuannersuite-(Ce)	NaCeBa3(PO4)3F0.5Cl0.5	6:1		Trigonal	PШаблон:Overbar	a = 9.909 c = 7.402	629.42	4.51
Lacroixite	NaAl(PO4)F	1:1		Monoclinic	B2/b	a = 6.414 b = 8.207 c = 6.885 β = 115.47°	327.20	3.126 - 3.29	Biaxial (-) nα = 1.546 nβ = 1.563 nγ = 1.580 2V: measured: 89° Birefringence: 0.034
Mcauslanite	Fe3Al2(PO4)3(PO3OH)F · 18H2O	4:1		Triclinic		a = 10.05 b = 11.56 c = 6.88 α = 105.84°, β = 93.66°, γ = 106.47°	728.7		Biaxial (-) nα = 1.522 nβ = 1.531 nγ = 1.534 2V: measured: 55° to 59.7°, calculated: 58° Max birefringence:δ = 0.012
Minyulite	KAl2(PO4)2(OH,F) · 4H2O	2:~1		Orthorhombic	Pba2	a = 9.34 b = 9.74 c = 5.52	502	2.47	Biaxial (+) nα = 1.531 nβ = 1.534 nγ = 1.538 2V: measured: 70° , calculated: 82° Max birefringence: δ = 0.007
Miyahisaite	(Sr,Ca)2Ba3(PO4)3F	3:1		Hexagonal	P63/m	a = 9.921, c = 7.469 Z=2	636.7	4.511
Morinite	NaCa2Al2(PO4)2(OH)F4 · 2H2O	2:4		Monoclinic				2.94	Biaxial (-) nα = 1.551 nβ = 1.563 nγ = 1.565 2V: measured: 43° , calculated: 44° Max birefringence: δ = 0.014
Nacaphite	Na2Ca(PO4)F			Monoclinic	P21/b	a = 13.318 b = 7.0964 c = 10.6490 β = 113.526° Z=8	922.81		Biaxial (-) nα = 1.508 nβ = 1.515 nγ = 1.520 2V: 80° Max birefringence: δ = 0.012
natrophosphate	Na7(PO4)2F.19H2O	2:1		Isometric	Fd3c	a = 27.79 Z=56	21,461.78	1,71-1.72	Isotropic
Nefedovite	Na5Ca4(PO4)4F	4:1		Triclinic		a = 5.4 Å, b = 11.64 Å, c = 16.48 Å α = 134.99°, β = 90.04°, γ = 89.96°	732.60		Biaxial (+) nα = 1.571 nγ = 1.590 Max birefringence: δ = 0.019
Nevadaite	(Cu2+,Al,V3+)6Al8(PO4)8F8(OH)2 · 22H2O	8:8		Orthorhombic	P21mn	a = 12.123 b = 18.999 c = 4.961		2.54	Biaxial (-) nα = 1.540 nβ = 1.548 nγ = 1.553 2V: measured: 76°, calculated: 76° Max birefringence: δ = 0.013
Panasqueiraite	CaMg(PO4)(OH,F)	1:~1		monoclinic		a = 6.53 b = 8.75 c = 6.91 β = 112.33°	365.2	3.27	Biaxial (+) nα = 1.590 nβ = 1.596 nγ = 1.616 2V: measured: 51° , calculated: 58° Max birefringence: δ = 0.026
Richellite	CaFe3+2(PO4)2(OH,F)2	2:~2				a = 5.18 c = 12.61
Stronadelphite	Sr5(PO4)3F	3:1		Hexagonal	P63/m	a = 9.845 c = 7.383	619.72		Uniaxial (-) nω = 1.630(1) nε = 1.623(1) Max birefringence: δ = 0.007
Triplite	Mn2+2(PO4)F	1:1		Monoclinic	P21/b	a = 11.9 b = 6.52 c = 10.09 β = 105.62°	758.4	3.9	Biaxial (+) nα = 1.650 nβ = 1.660 nγ = 1.680 2V: measured: 70° to 90°, calculated: 72° Max birefringence: δ = 0.030
Väyrynenite	Mn2+Be(PO4)(OH,F)	1:~1		Monoclinic	P21/b	a = 5.411 b = 14.49 c = 4.73 β = 102.75°	361.71	3.22	Biaxial (-) nα = 1.638 - 1.640 nβ = 1.658 - 1.662 nγ = 1.664 - 1.667 2V: measured: 46° to 55°, Ccalculated: 51° to 57° Max birefringence: δ = 0.026 - 0.027
Viitaniemiite	Na(Ca,Mn2+)Al(PO4)(F,OH)3	1:~3		Monoclinic		a = 6.83 b = 7.14 c = 5.44 β = 109.37°	250.27		Biaxial (-) nα = 1.557 nβ = 1.565 nγ = 1.571 2V: measured: 81° , calculated: 80° Max birefringence: δ = 0.014
Wagnerite	(Mg,Fe2+)2(PO4)F	1:1		Monoclinic	P21/b	a = 9.645 b = 31.659 c = 11.914 β = 108.26(3)°	3454.8	3.15	Biaxial (+) nα = 1.568 nβ = 1.572 nγ = 1.582 2V: Measured: 25° to 35° ? Birefringence:0.046 Max birefringence: δ = 0.015
Wavellite	Al3(PO4)2(OH,F)3 · 5H2O	2:~3		Orthorhombic		a = 9.621 b = 17.363 c = 6.994	1168.3	2.36	Biaxial (+) nα = 1.518 - 1.535 nβ = 1.524 - 1.543 nγ = 1.544 - 1.561 2V: measured: 60° to 72°, calculated: 60° to 70° Max birefringence: δ = 0.026
Zwieselite	Fe2+2(PO4)F	1:1		Monoclinic	P21/b		753.82		Biaxial (+) nα = 1.686 - 1.696 nβ = 1.690 - 1.704 nγ = 1.703 - 1.713 2V: measured: 58° , calculated: 60° Max birefringence: δ = 0.017
	Na5-4.5PO4(CO3,F,Cl)	1:~1

Artificial

name	formula	formula weight	crystal system	space group	unit cell Å	volume	density	refractive index	comment	reference
Iron-Doped Sodium–Vanadium Fluorophosphate	Na3V2–yO2–yFey(PO4)2F1+y (y < 0.3)		tetrahedral	P42/mnm	a=9.0277 c=10.6259	866.0
	Na3V2O1.6(PO4)2F1.4
	Na3V2(PO4)2F3
	Na2MnPO4F
α	Na2FePO4F		monoclinic	P21/c	a = 13.675, b = 5.2503, c = 13.7202, β = 120.230°
β	Na2FePO4F		orthorhombic
MIL-145	RbGa3(PO4)2(HPO4)F4·C5N2H16·2H2O	3187.11	monoclinic	P2	a=14.4314 b=9.1152 c=16.7889 β = 112.708 Z=1	2037.30	2.598		colourless
	K2SnPO4F3	348.86	monoclinic	P21/c	a=10.039 b=9.415 c=21.602 beta=95.464 Z=12	2032.6	3.420		colourless
	K6Sn(P2O7)2F2	739.17	monoclinic	P21/c	a=8.515 b=12.400 c=8.403 beta=99.58 Z=29	874.8	2.806		colourless
	K2Sb(P2O7)F		tetragonal	P4bm	a=8.5239 c=5.572 Z=2	404.8	3.223		colourless SHG 4.0×KDP
	Na2PrF2(PO4)		cubic
	Na2NdF2(PO4)		cubic
	Na2SmF2(PO4)		cubic
	Na2EuF2(PO4)		cubic
	Na2TbF2(PO4)		cubic
	Na2PrF2(PO4)		cubic
	PbZn(PO4)F	386.53	orthorhombic	Pna21	a=8.985 b=9.381 c=4.8212 Z=4	406.4	6.318		colourless