Английская Википедия:Hexaborane(12)

Материал из Онлайн справочника
Версия от 06:56, 21 марта 2024; EducationBot (обсуждение | вклад) (Новая страница: «{{Английская Википедия/Панель перехода}} {{Chembox | ImageFile = B6H12.png | ImageSize = | ImageAlt = | ImageFile1 = Hexaborane(12)-GED-view-1-3D-bs-17.png | IUPACName = | OtherNames = | Section1 = {{Chembox Identifiers | CASNo_Ref = | CASNo = 12008-19-4 | RTECS = | EINECS = | StdInChI=1S/B6H16/c1-2-5(1)6-3-4-6/h5-6H2,1-4H3 | StdInChIKey = QXTIDELWZZSOOU-UHFFFAOYSA-N | SMILES = [BH3]1...»)
(разн.) ← Предыдущая версия | Текущая версия (разн.) | Следующая версия → (разн.)
Перейти к навигацииПерейти к поиску

Шаблон:Chembox

Hexaborane(12) is an inorganic compound with the formula B6H12. It is an obscure member of the boranes. It is a colorless liquid that, like most boron hydrides, is readily hydrolyzed and flammable.

The molecular structure conforms to C2 symmetry group. With the formula BnHn+6, it is classified as an arachno-cluster. As such the boron positions match six of the boron positions in the closo-B8HШаблон:Su.

Preparation

It is typically prepared by the cluster expansion method from B5HШаблон:Su, the conjugate base of pentaborane(9):[1]

LiB5H8 + 1/2 B2H6 → LiB6H11
LiB6H11 + HCl → B6H12 + LiCl

References

Шаблон:Reflist

Шаблон:Boron compounds Шаблон:Hydrides by group


Шаблон:Inorganic-compound-stub