Английская Википедия:Borate fluoride

Материал из Онлайн справочника
Перейти к навигацииПерейти к поиску

The borate fluorides or fluoroborates are compounds containing borate or complex borate ions along with fluoride ions that form salts with cations such as metals. They are in the broader category of mixed anion compounds. They are not to be confused with tetrafluoroborates (BF4) or the fluorooxoborates which have fluorine bonded to boron.

Examples

formula name mw system space group unit cell Å volume Å3 density comment references
Be2(BO3)(OH,F) · H2O Berborite trigonal P3 a = 4.434, c = 5.334 90.82 colourless

Uniaxial (-) nω = 1.580 nε = 1.485

Max birefringence δ = 0.095

[1]

γ‐Be2BO3F γ‐BBF 95.83 trigonal R32 a=4.4418 c=19.909 Z=3 340.17 1.946 Uniaxial (-) SHG 2.3 × KDP
NH4Be2BO3F2 ABBF 132.87 trigonal R32 a=4.4398 c=12.4697 Z=3 212.87 2.243 Uniaxial (-) no=1.49389 ne=1.41919 at 636 nm [2]
NaBe2BO3F2 sodium beryllium borate fluoride (NBBF) C2 a=12.643 b=8.729 c=7.591 β=113.6° 768 double layers of borate rings sandwiching barium atoms. Between pairs of double layers are sodium ions with fluoride. [3]
Mg2(BO3)(F,OH) Pertsevite-(F) orthorhombic Pna21 a = 20.49, b = 4.571, c = 11.89 Z=16 1,113.6 Density 3.12

transparent

Biaxial (+) nα = 1.609 nβ = 1.620 nγ = 1.642

2V: 65°

Max birefringence: δ = 0.033

[4]
Mg3(BO3)(F,OH)3 Fluoborite hexagonal a = 8.8, c = 3.1 208 colourless

Uniaxial (-) nω = 1.570 nε = 1.534

Max birefringence δ = 0.036

[5]
Mg3(OH)[B(OH)4]2(SO4)F sulfoborite orthorhombic Pnma a=10.132 b=12.537 c=7.775 987.6 Biaxial (-) nα = 1.527 nβ = 1.536 nγ = 1.551

2V 79°

Max birefringence δ = 0.024

[6]
Na6Mg3B10O18F6 monoclinic P21/c a=13.420 b=6.400 c=10.701 β=90.693° band gap 5.40 eV; birefringence Δn = 0.039 at 1064 nm [7]
Al6(BO3)5F3

Jeremejevite

hexagonal

P63/m

a = 8.5591, c = 8.1814

519

density 3.28

Uniaxial (-) nω = 1.653 nε = 1.640

Max birefringence δ = 0.013

[8][9]
Al8(BO3)4(B2O5)F8 704.7 tetragonal P42/mmc a=9.134 c=19.112 Z=4 1,595 density 2.935 colourless [8]
Na(Mg3)Al6(Si6O18)(BO3)3(OH)3F Fluor-dravite trigonal R3m a = 15.955, c = 7.153 Z=3 1,577 density 3.120

dark brown

Uniaxial (-) nω = 1.645(2) nε = 1.621(2)

Max birefringence δ = 0.024

[10]
Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F Fluor-elbaite trigonal R3m a = 15.8933, c = 7.1222 1,558 blue green

Uniaxial (-)

[11]
K6B12O19F4 744.32 orthorhombic Pnma a =15.291 b =7.707 c =8.672 Z=2 1022.0 2.419 [12]
KBe2BO3F2 KBBF hexagonal R32 a=4.427 c=18.744 318.3 2.40 Be2BO6F2 rings SHG 1.2 × KDP; UV cutoff 147 nm [13]
Li3CaB2O5F 363.04 orthorhombic Pnma a=25.685 b=3.4697 c=5.4404 Z=2 484.84 2.487 colourless [14]
Li5Ca9(BO3)7F2 P1
NaCaBe2B2O6F [15]
KCaBe2B2O6F 467.64 P3_1c a=4.705 c=14.554 Z=2 279.1 2.783 [16]
Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F Fluor-liddicoatite trigonal R3m a = 15.875, c = 7.126 Z=3 1,555 density 3.02

Uniaxial (-) nω = 1.637 nε = 1.621

Max birefringence δ = 0.016

[17]
CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F Fluor-uvite trigonal R3m a = 15.954, c = 7.214 Z=3 1,590 black

Uniaxial nω = 1.637 - 1.668 nε = 1.619 - 1.639

Max birefringence δ = 0.018 - 0.029

[18]
KCaBe2B2O6F
Sc2F2(B2O5) 229.54 orthorhombic Pbam a=9.667 b=14.199 c=4.0395 Z=4 554.4 2.750 colourless [19]
K11Sc5(B5O10)4F6 orthorhombic Fdd2 a 56.769 b 12.207 c 12.6088 transparent to <190 nm [20]
Na(Mn2+)3Al6(Si6O18)(BO3)3(OH)3F Fluor-tsilaisite trigonal R3m a = 15.9398, c = 7.1363 1,570 greenish yellow

Uniaxial (-)

[21]
NaFe3Al6Si6B3O30F [8]
Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3F Fluor-schorl trigonal R3m a = 16.005, c = 7.176 Z=3 1,591.9 black

Uniaxial (-) nω = 1.660 - 1.661 nε = 1.636 - 1.637

Max birefringence δ = 0.024

[22]
Na(Fe3+3)Al6(Si6O18)(BO3)3O3F Fluor-buergerite trigonal R3m a = 15.8692, c = 7.1882 1,568 density 3.311

brown

Uniaxial (-) nω = 1.735 nε = 1.655

Birefringence 0.080

[23]
Ca(Fe2+)3MgAl5(Si6O18)(BO3)3(OH)3F Fluor-feruvite [24]
KCaZn2(BO3)2F
Li6RbB2O6F 263.73 orthorhombic Pnma a=8.41 b=15.96 c=5.08 Z=2 682 2.568 [25]
RbBe2BO3F2 RBBF Trigonal R32 a=4.434 c=19.758 z=3 also contains BeO3F tetrahedra and BO3. It transmits radiation from 180 to 3500 nm. [26]
Rb18Mg6(B5O10)3(B7O14)2F monoclinic C2/c a=11.06 b=19.70 c=31.01 β=90.13° [27]
RbCaBe2B2O6F Trigonal R32 [28]
KSrBe2B2O6F [15]
LiSr3Be3B3O9F4 [29]
NaSr3Be3B3O9F4 [30]
K3Sr3Li2Al4B6O20F SHG 4 × KDP; 170 nm UV cutoff [8]
Ca(Y,REE,Ca,Na,Mn)15Fe2+(P,Si)Si6B3O34F14 Proshchenkoite-(Y) trigonal R3m a = 10.7527, c = 27.4002 2,743.6 brownish [31]
(Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1−x)(Si,As5+)Si6B3(O,F)48 Hundholmenite-(Y) trigonal R3m a = 10.675, c = 27.02 Z=3 2,667 density 5.206

brownish

Uniaxial (-)

[32]
(Na,Ca)3(Y,Ce)12Si6B2O27F14 Okanoganite-(Y) trigonal R3m a = 10.7108, c = 27.040 4.35 Tan coloured

Uniaxial (-) nω = 1.753 nε = 1.740

Max birefringence δ = 0.013

[33]
? Y5(SiO4,BO4)3(O,OH,F) Tritomite-(Y) ?hexagonal a = 9.32, c = 6.84 3.05-3.4 isotropic

n = 1.627 - 1.685

Cd8B5O15F 1212.25 cubic FdШаблон:Overbarm a = 13.972 Z = 8 2,727 5.904 colourless [34]
CdZn2KB2O6F
Li3Cs6Al2B14O28F 1490.58 orthorhombic Pnma a=21.8412 b=19.8875 c=7.1577 Z=4 3109.1 3.184 [35]
CsBe2BO3F2 247.74 trigonal R32 a=4.4575 c=21.310 Z=3 366.7 3.366 colourless [36]
Cs18Mg6(B5O10)3(B7O14)2F monoclinic C2/c a=11.234 b=20.11 c=32.12 β=90.225° [27]
CsCaBe2B2O6F trigonal R32 [37]
BaBOF3 221.15 monoclinic P21/c a = 4.620 b = 15.186 c = 4.426 β = 92.045° Z=4 310.3 contains chains of -OB(F2)- and a double chain of BaF [38]
Ba5(BO3)3F [39]
Li2BaSc(BO3)2F 332.80 hexagonal P63/m a=4.895 c=14.346 297.7 3.713 [40]
LiBa12(BO3)7F4 I4/mcm
BaBe2BO3F3 271.16 hexagonal P63 a=7.628 c=13.990 Z=6 704.9 3.832 UV cutoff <185 nm; birefringence 0,081 at 200 nm [41]
NaBa12(BO3)7F4 I4/mcm
BaMgBe2(BO3)2F2 BMBBF 335.283 trigonal PШаблон:Overbarc1 a=4.5898 c=15.348 280.01 3.976 colourless [Be2B3O6F2]∞ [42]
Ba3.75MgB7O14F2.5 886.50 monoclinic C2/c a 16.611 b 13.677 c 15.141 β 121.239° Z=8 2941.0 4.004 transparent > 203 nm; birefringence 0.081@546 nm [43]
BaAl(BO3)F2 hexagonal PШаблон:Overbar a=4.8879 c=9.403 Z=2 194.5 UV cutoff 165 nm [44]
K3Ba3Li2Al4B6O20F [8]
K5Ba10(BO3)8F trigonal RШаблон:Overbarc a = 15.293, c = 22.699 Z = 6 [45]
KBa7Mg2B14O28F5 monoclinic C2/c a = 16.638 b = 13.609 c = 15.214 β = 121.309° Z=4 2943.3 3.934 colourless [46]
BaCaBe2(BO3)2F2 BCBBF trigonal PШаблон:Overbarc1 a=4.6931 c=16.049 306.12 3.808 colourless [Be2B3O6F2]∞ [42]
Li2BaSc(BO3)2F hexagonal P63/m a=4.895 c=14.346 [47]
Ba3Zn(BO3)(B2O5)F 656.82 monoclinic P21/c a = 15.179 b = 7.0064 c = 8.763 β = 100.15° Z=4 917.4 4.755 colourless [48]
Ba4Zn2(BO3)2(B2O5)F2 937.34 monoclinic C2/c a=20.39 b=4.998 c=13.068 β = 192.59 Z=44 1,331 4.679 colourless [48]
BaZnBe2(BO3)2F2 376.35 trigonal PШаблон:Overbar a = 4.5998, c = 7.7037 Z = 1 141.16 4.427 colourless [49]
Rb3Ba3Li2Al4B6O20F [8]
Ba1.09Pb0.91Be2(BO3)2F2 BPBBF trigonal PШаблон:Overbarm1 a = 4.7478 c = 8.386, Z = 1 163.70 UV absorption edge=279.1 nm; birefringence 0.054 at 546.1 nm; 2D [Be3B3O6F3]∞ layer [50]
LiBa2Pb(BO3)2F orthorhombic Pmmn a=5.487 b=15.96 c=4.034 [47]
KNa3Na6Ca2Ba6Mn6(Ti4+,Nb)6B12Si36O114(O,OH,F)11 Tienshanite hexagonal P6/m a = 16.785, c = 10.454 Z=1 2,551 pale olive green

Uniaxial (-) nω = 1.666 nε = 1.653

Max birefringence δ = 0.013

[51]
Ca6(Fe2+,Mn2+)Y3REE7(SiO4)3(PO4)(B3Si3O18)(BO3)F11 Laptevite-(Ce) trigonal R3m a = 10.804, c = 27.726 Z=3 2,803 density 4.61

dark brown

Uniaxial (-) nω = 1.741(3) nε = 1.720(3)

Max birefringence δ = 0.021

[52]
Ba(Y,Ce)6Si3B6O24F2 Cappelenite-(Y) trigonal P3 a = 10.67, c = 4.68 Z=1 461 4.407 greenish brown [53]
CaMg[(Ce7Y3)Ca5](SiO4)4(Si2B3AsO18)(BO3)F11 Arrheniusite-(Ce) trigonal R3m a = 10.8082, c = 27.5196 [54]
Gd4(BO2)O5F orthorhombic Pmmn a=15.746 b=3.8142 c=6.609 Z=2 396.9 6.45 colourless [55]
Gd2(BO3)F3
Gd3(BO3)2F3
Gd4[B4O11]F2
Eu5(BO3)3F orthorhombic Pnma a=7.225 b=14.124 c=9.859 Z=4 1006.1 6.306 yellow [56]
TlBe2BO3F2 Trigonal R32 a=4.4387 c=19.942 Z=3 340.27 4.673 colourless [57]
LiBa2Pb(BO3)2F orthorhombic Pmmn a=5.487 b=15.97 c=4.034 353.4 5.887 colourless [58]
(Ca,Ce,La,Th)15As5+(As3+0.5,Na0.5)Fe3+Si6B4O40F7 Vicanite-(Ce) trigonal R3m a=10.881 c=27.33 2,766 4.82 greenish yellow

Uniaxial (-) nω = 1.757 nε = 1.722

Max birefringence δ = 0.035

[59]

References

Шаблон:Reflist

Шаблон:Borates Шаблон:Fluorides

Партнерские ресурсы
Криптовалюты
Магазины
Хостинг
Разное

  1. ↑ Шаблон:Cite web
  2. ↑ Шаблон:Cite journal
  3. ↑ Шаблон:Cite journal
  4. ↑ Шаблон:Cite web
  5. ↑ Шаблон:Cite web
  6. ↑ Шаблон:Cite web
  7. ↑ Шаблон:Cite journal
  8. ↑ 8,0 8,1 8,2 8,3 8,4 8,5 Шаблон:Cite journal
  9. ↑ Шаблон:Cite web
  10. ↑ Шаблон:Cite web
  11. ↑ Шаблон:Cite web
  12. ↑ Шаблон:Cite journal
  13. ↑ Шаблон:Cite journal
  14. ↑ Шаблон:Cite journal
  15. ↑ 15,0 15,1 Шаблон:Cite journal
  16. ↑ Шаблон:Cite journal
  17. ↑ Шаблон:Cite web
  18. ↑ Шаблон:Cite web
  19. ↑ Шаблон:Cite journal
  20. ↑ Шаблон:Cite journal
  21. ↑ Шаблон:Cite web
  22. ↑ Шаблон:Cite web
  23. ↑ Шаблон:Cite web
  24. ↑ Шаблон:Cite web
  25. ↑ Шаблон:Cite journal
  26. ↑ Шаблон:Cite journal
  27. ↑ 27,0 27,1 Шаблон:Cite journal
  28. ↑ Шаблон:Cite journal
  29. ↑ Шаблон:Cite journal
  30. ↑ Шаблон:Cite journal
  31. ↑ Шаблон:Cite web
  32. ↑ Шаблон:Cite web
  33. ↑ Шаблон:Cite web
  34. ↑ Шаблон:Cite journal
  35. ↑ Шаблон:Cite journal
  36. ↑ Шаблон:Cite journal
  37. ↑ Шаблон:Cite journal
  38. ↑ Шаблон:Cite journal
  39. ↑ Шаблон:Cite journal
  40. ↑ Шаблон:Cite journal
  41. ↑ Шаблон:Cite journal
  42. ↑ 42,0 42,1 Шаблон:Cite journal
  43. ↑ Шаблон:Cite journal
  44. ↑ Шаблон:Cite journal
  45. ↑ Шаблон:Cite journal
  46. ↑ Шаблон:Cite journal
  47. ↑ 47,0 47,1 Шаблон:Cite journal
  48. ↑ 48,0 48,1 Шаблон:Cite journal
  49. ↑ Шаблон:Cite journal
  50. ↑ Шаблон:Cite journal
  51. ↑ Шаблон:Cite web
  52. ↑ Шаблон:Cite web
  53. ↑ Шаблон:Cite web
  54. ↑ Шаблон:Cite web
  55. ↑ Шаблон:Cite journal
  56. ↑ Шаблон:Cite journal
  57. ↑ Шаблон:Cite journal
  58. ↑ Шаблон:Cite journal
  59. ↑ Шаблон:Cite web
Источник — http://wikihandbk.com/ruwiki/index.php?title=Английская_Википедия:Borate_fluoride&oldid=13590789