Английская Википедия:Chloride sulfite
Шаблон:Short description A chloride sulfite or sulfite chloride is a chemical compound that contains chloride and sulfite anions (SO32− Cl−). The known compounds of this type are all late transition metal sulfito complexes. Chlorine may be present as a ligand (chloro) or as an ion (chloride). The sulfito ligand can connect to the metal atom by way of an oxygen, or a sulfur atom. It can also link to the metal atom using two oxygen atoms as a bidentate ligand.
Chloride sulfites are not to be confused with the chlorosulfites, which are compounds containing the SO2Cl− ion or -SO2Cl group in organic compounds, where it is also called chlorosulfinate. The chlorosulfates also have the formula SO3Cl− as a single ion, whereas chloride sulfites have three negative charges.
The mercury complex with formula ClHgSO3− is found in the acid gas scrubbers that purify pollution from smokestacks. However it decomposes and does not capture mercury in this application.[1] This complex can form an ammonium salt: ammonium chlorosulfitomercurate(II) NH4[ClHgSO3], which decomposes over 130°C. The salt is formed from mercuric chloride and ammonium sulfite water solutions.[2]
List
| name | formula | ratio
SO3:Cl |
mw | system | space group | unit cell | volume | density | optical | references |
|---|---|---|---|---|---|---|---|---|---|---|
| chlorosulfito bis-(1,2-diaminopropane)cobalt(III) monohydrate | Co(NH2CH2CH2CH2NH2)2(SO3)Cl·H2O | 1:1 | red brown | [3] | ||||||
| chlorosulfito bis-(1,2-diaminopropane)cobalt(III) tetrahydrate sodium chloride | Co(NH2CH2CH2CH2NH2)2(SO3)Cl·4H2O·NaCl | 1:1 | brown | [3] | ||||||
| chlorosulfito (1,2-diaminopropane)(ethylenediamine)cobalt(III) monohydrate sodium chloride | Co(NH2CH2CH2CH2NH2)(NH2CH2CH2NH2)(SO3)Cl·H2O·NaCl | 1:1 | brick red | [3] | ||||||
| chlorosulfito bis-(ethylenediamine)cobalt(III) monohydrate | [Co(NH2CH2CH2NH2)2(SO3)Cl]·H2O | 1:1 | pink brown | [4] | ||||||
| ammino sulfito bis-(ethylenediamine)cobalt(III) chloride | [Co(NH2CH2CH2NH2)2(SO3)NH3]Cl | yellow brown | [4] | |||||||
| sulfito bis-(ethylenediamine)cobalt(III) chloride | [Co(NH2CH2CH2NH2)2(SO3)]Cl | brown-red | [4] | |||||||
| sulfito tetraammino chloro osmium | OsSO3(NH3)4Cl | 1:1 | pink brown | [5] | ||||||
| Na6[Os(SO3)4Cl2]·10H2O | 4:2 | purple | [6] | |||||||
| Na7[Os(SO3)5Cl]·6H2O | 5:1 | pale violet | [6] | |||||||
| K8[Os(SO3)4Cl4] | 4:4 | brown | [6] | |||||||
| sulfito aquo octaammino μ-nitrido diosmium trichloride | [Os2N(SO3)(NH3)8H2O]Cl3 | 1:3 | yellow brown | [5] | ||||||
| Na2[Ir(SO3)2(NH4)3Cl] | 2:1 | [7][8] | ||||||||
| trisodium diaquadichlorodisulfitoiridate(III) heptahydrate | Na3[IrCl2(SO3)2(OH2)2]·7H2O | Pnma | Z=4 | yellow | [9] | |||||
| trisodium disulfito dichloro diammino iridium tetrahydrate | Na3[Ir(SO3)2(NH4)2Cl2]·4H2O | 2:2 | [5] | |||||||
| trisodium disulfito dichloro diammino iridium hexahydrate | Na3[Ir(SO3)2(NH4)2Cl2]·6H2O | 2:2 | pale yellow | [5] | ||||||
| tripotassium diaquadichlorodisulfitoiridate(III) dihydrate | K3[IrCl2(SO3)2(OH2)2]·2H2O | C2 | Z=2 | yellow | [9] | |||||
| Na5[Ir(SO3)2Cl4] | 2:4 | [7] | ||||||||
| pentapotassium disulfito tetrachloro iridium hexahydrate | K5[Ir(SO3)2Cl4]·6H2O | light orange | [5] | |||||||
| pentasodium dichlorobis(hydrogendisulfito)iridate(III) | trans-Na5[IrCl2{(SO3H)(SO3)}2]·10H2O | C2/c | pale yellow | [9] | ||||||
| pentapotassium dichlorobis(hydrogendisulfito)iridates(III) | trans-K5[IrCl2{(SO3H)(SO3)}2]·5H2O | pale yellow | [9] | |||||||
| Na7[Ir(SO3)4Cl2] | 4:2 | [7] | ||||||||
| hepta sodium tetrasulfito dichloro iridium heptahydrate | Na7[Ir(SO3)4Cl2]·7H2O | pale yellow | [5] | |||||||
| K7[Ir(SO3)2(NO3)2Cl] | 4:2 | [7][10] | ||||||||
| (NH4)5lr(SO3)2Cl4 | 2:4 | monoclinic | P21/n | a = 11.10 b = 7.25 c = 7.25 β= 96.5 Z = 2 | [11] | |||||
| (NH4)4lr(SO3)2Cl3·4H2O | 2:3 | monoclinic | a = 10.44 b = 9.46 c = 7.48 β = 90.5, Z = 2 | [11] | ||||||
| NH4[ClHgSO3] | 1:1 | Pnma | a=15.430 b=5.525 c=6.679 Z=4 | [2] | ||||||
| K[HgSO3Cl]·KCl·H2O | 1:2 | 761.18 | triclinc | P1_ | a = 6.1571 b = 7.1342 c = 10.649 α = 76.889, β = 88.364, γ = 69.758° Z=4 | 426.8 | 4.358 | [12] | ||
| K[HgSO3Cl]·KCl·HgCl2 | 1:4 | 701.24 | monoclinic | P21/m | a=9.532 b=5.9593 c=10.176 β =110.522 Z=2 | 541.3 | 4.302 | [12] | ||
| K[HgSO3Cl]·HgCl2 | 1:3 | 626.69 | orthorhombic | Cmc21 | a=5.9313 b=21.746 c=6.7899 Z=4 | 879.79 | 4.753 | [12] | ||
| NH4[HgSO3Cl]·HgCl2 | 1:3 | 605.65 | orthorhombic | Cmc21 | a=5.962 b=22.247 c=6.958 Z=4 | 923.0 | 4.358 | [12] | ||
| NH4[HgSO3Cl]·HgCl2·NH4Cl | 1:4 | 659.12 | monoclinic | P21/m | a=9.712 b=6.138 c=10.401 β =110.92 Z=2 | 579.2 | 3.779 | [12] | ||
| (K[HgSO3Cl])2·KCl·HgCl2 | 2:5 | 1056.44 | orthorhombic | Pnma | a=22.158 b=5.9736 c=12.249 Z=4 | 1621.2 | 4.328 | [12] |
References
- ↑ Шаблон:Cite journal
- ↑ 2,0 2,1 Шаблон:Cite journal
- ↑ 3,0 3,1 3,2 Шаблон:Cite journal
- ↑ 4,0 4,1 4,2 Шаблон:Cite journal
- ↑ 5,0 5,1 5,2 5,3 5,4 5,5 Шаблон:Cite journal
- ↑ 6,0 6,1 6,2 Шаблон:Cite book
- ↑ 7,0 7,1 7,2 7,3 Шаблон:Cite book
- ↑ Ferrari, A., and C. Colla. "Iridionitrites of ammonium, potassium, rubidium, cæsium and thallium." Gazzetta Chimica Italiana 63 (1933): 507-513
- ↑ 9,0 9,1 9,2 9,3 Шаблон:Cite journal
- ↑ russ j inor chem 6 1961 1247
- ↑ 11,0 11,1 Шаблон:Cite journal
- ↑ 12,0 12,1 12,2 12,3 12,4 12,5 Шаблон:Cite journal
