Английская Википедия:Ethenolysis

Материал из Онлайн справочника
Перейти к навигацииПерейти к поиску

Шаблон:Short description

In organic chemistry, ethenolysis is a chemical process in which internal olefins are degraded using ethylene (Шаблон:Chem2) as the reagent. The reaction is an example of cross metathesis. The utility of the reaction is driven by the low cost of ethylene as a reagent and its selectivity. It produces compounds with terminal alkene functional groups (α-olefins), which are more amenable to other reactions such as polymerization and hydroformylation.

The general reaction equation is:

<math chem>\ce{A=B} + {\color{red}\ce{CH2=CH2}} \longrightarrow \ce{A=}{\color{red}\ce{CH2}} + \ce{B=}{\color{red}\ce{CH2}}</math>

Ethenolysis is a form of methylenation, i.e., the installation of methylene (Шаблон:Chem2) groups.

Applications

Using ethenolysis, higher molecular weight internal alkenes can be converted to more valuable terminal alkenes. The Shell higher olefin process (SHOP process) uses ethenolysis on an industrial scale. The SHOP α-olefin mixtures are separated by distillation, the higher molecular weight fractions are isomerized by alkaline alumina catalysts in the liquid phase. The resulting internal olefins are reacted with ethylene to regenerate α-olefins. The large excess of ethylene moves the reaction equilibrium to the terminal α-olefins. Catalysts are often prepared from Rhenium(VII) oxide (Шаблон:Chem2) supported on alumina.[1]

In one application, neohexene, a precursor to perfumes, is prepared by ethenolysis of diisobutene:[2]

<math chem>\overset{\text{diisobutene}}{\ce{(CH3)3C-CH=C(CH3)2}} + {\color{red}\ce{CH2=CH2}} \longrightarrow \overset{\text{neohexane}}{\ce{(CH3)3C-CH=}{\color{red}\ce{CH2}}} + \ce{(CH3)2C=}{\color{red}\ce{CH2}}</math>

α,ω-Dienes, i.e., diolefins of the formula Шаблон:Chem2, are prepared industrially by ethenolysis of cyclic alkenes. For example, 1,5-hexadiene, a useful crosslinking agent and synthetic intermediate, is produced from 1,5-cyclooctadiene:

<math chem>\ce{(CH2CH=CHCH2)2} + 2{\color{red}\ce{CH2=CH2}} \longrightarrow \ce{2(CH2)2(CH=}{\color{red}\ce{CH2}}\ce{)2}</math>

The catalyst is derived from rhenium(VII) oxide supported on alumina.[2] 1,9-Decadiene, a related species, is produced similarly from cyclooctene.

In an application directed at using renewable feedstocks,[3] methyl oleate, derived from natural seed oils, can be converted to 1-decene and methyl 9-decenoate:[4][5]

<math chem>\ce{CH3(CH2)7CH=CH(CH2)7CO2Me} + {\color{red}\ce{CH2=CH2}} \longrightarrow \ce{CH3(CH2)7CH=}{\color{red}\ce{CH2}} + \ce{MeO2C(CH2)7CH=}{\color{red}\ce{CH2}}</math>

References

  1. K. Weissermel, H. J. Arpe: Industrial Organic Chemistry: Important Raw Materials and Intermediates. Wiley-VCH Verlag 2003, Шаблон:ISBN
  2. 2,0 2,1 Шаблон:Cite encyclopedia
  3. Шаблон:Cite journal
  4. Шаблон:Cite journal
  5. Шаблон:Cite journal